C11H9F3N4O2S — CID 29070293
2-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]sulfanylacetic acid (PubChem CID 29070293) has the molecular formula C11H9F3N4O2S and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]sulfanylacetic acid.
| Compound Name | 2-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 29070293 |
| Molecular Formula | C11H9F3N4O2S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 2-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]sulfanylacetic acid |
| SMILES | O=C(O)CSc1nnnn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N4O2S/c12-11(13,14)8-3-1-2-7(4-8)5-18-10(15-16-17-18)21-6-9(19)20/h1-4H,5-6H2,(H,19,20) |
| InChIKey | RKVXMMWLXGULSC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |