C16H14N4O3S — CID 27136129
2-(1-benzyltetrazol-5-yl)sulfanyl-1-(2,4-dihydroxyphenyl)ethanone (PubChem CID 27136129) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-1-(2,4-dihydroxyphenyl)ethanone.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-1-(2,4-dihydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 27136129 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-1-(2,4-dihydroxyphenyl)ethanone |
| SMILES | O=C(CSc1nnnn1Cc1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14N4O3S/c21-12-6-7-13(14(22)8-12)15(23)10-24-16-17-18-19-20(16)9-11-4-2-1-3-5-11/h1-8,21-22H,9-10H2 |
| InChIKey | PXQASCQWRCDQQN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |