C12H14F3N5 — CID 103085277
N-methyl-1-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]ethanamine (PubChem CID 103085277) has the molecular formula C12H14F3N5 and a molecular weight of 285.27 g/mol. Its IUPAC name is N-methyl-1-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]ethanamine.
| Compound Name | N-methyl-1-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103085277 |
| Molecular Formula | C12H14F3N5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-methyl-1-[1-[[3-(trifluoromethyl)phenyl]methyl]tetrazol-5-yl]ethanamine |
| SMILES | CNC(C)c1nnnn1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3N5/c1-8(16-2)11-17-18-19-20(11)7-9-4-3-5-10(6-9)12(13,14)15/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | QOSGCQFFPJXFGB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |