C11H14F2N4O3 — CID 102644652
1-[2-(cyclopentylamino)-2-oxoethyl]-5-(difluoromethyl)triazole-4-carboxylic acid (PubChem CID 102644652) has the molecular formula C11H14F2N4O3 and a molecular weight of 288.25 g/mol. Its IUPAC name is 1-[2-(cyclopentylamino)-2-oxoethyl]-5-(difluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(cyclopentylamino)-2-oxoethyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644652 |
| Molecular Formula | C11H14F2N4O3 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-[2-(cyclopentylamino)-2-oxoethyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(Cn1nnc(C(=O)O)c1C(F)F)NC1CCCC1 |
| InChI | InChI=1S/C11H14F2N4O3/c12-10(13)9-8(11(19)20)15-16-17(9)5-7(18)14-6-3-1-2-4-6/h6,10H,1-5H2,(H,14,18)(H,19,20) |
| InChIKey | QIGGRHJBOWAZFL-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |