C13H12N6O2 — CID 102645084
1-(2-pyrazol-1-ylethyl)-5-pyridin-4-yltriazole-4-carboxylic acid (PubChem CID 102645084) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-(2-pyrazol-1-ylethyl)-5-pyridin-4-yltriazole-4-carboxylic acid.
| Compound Name | 1-(2-pyrazol-1-ylethyl)-5-pyridin-4-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645084 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-(2-pyrazol-1-ylethyl)-5-pyridin-4-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CCn2cccn2)c1-c1ccncc1 |
| InChI | InChI=1S/C13H12N6O2/c20-13(21)11-12(10-2-5-14-6-3-10)19(17-16-11)9-8-18-7-1-4-15-18/h1-7H,8-9H2,(H,20,21) |
| InChIKey | JGTCRWDOYOPZCZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |