C13H20N4O4 — CID 102646195
methyl 1-[3-(cyclopropylamino)-3-oxopropyl]-5-(2-methoxyethyl)triazole-4-carboxylate (PubChem CID 102646195) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 1-[3-(cyclopropylamino)-3-oxopropyl]-5-(2-methoxyethyl)triazole-4-carboxylate.
| Compound Name | methyl 1-[3-(cyclopropylamino)-3-oxopropyl]-5-(2-methoxyethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 102646195 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 1-[3-(cyclopropylamino)-3-oxopropyl]-5-(2-methoxyethyl)triazole-4-carboxylate |
| SMILES | COCCc1c(C(=O)OC)nnn1CCC(=O)NC1CC1 |
| InChI | InChI=1S/C13H20N4O4/c1-20-8-6-10-12(13(19)21-2)15-16-17(10)7-5-11(18)14-9-3-4-9/h9H,3-8H2,1-2H3,(H,14,18) |
| InChIKey | MHURRECWNAFEOA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |