C13H22O2 — CID 102646644
2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanol (PubChem CID 102646644) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanol.
| Compound Name | 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanol |
|---|---|
| PubChem CID | 102646644 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-cyclohexyl-1-(3,4-dihydro-2H-pyran-6-yl)ethanol |
| SMILES | OC(CC1CCCCC1)C1=CCCCO1 |
| InChI | InChI=1S/C13H22O2/c14-12(13-8-4-5-9-15-13)10-11-6-2-1-3-7-11/h8,11-12,14H,1-7,9-10H2 |
| InChIKey | HBHYTCVEWNNOHT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |