C10H16O2S — CID 102649744
3,4-dihydro-2H-pyran-6-yl(thiolan-2-yl)methanol (PubChem CID 102649744) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-6-yl(thiolan-2-yl)methanol.
| Compound Name | 3,4-dihydro-2H-pyran-6-yl(thiolan-2-yl)methanol |
|---|---|
| PubChem CID | 102649744 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3,4-dihydro-2H-pyran-6-yl(thiolan-2-yl)methanol |
| SMILES | OC(C1=CCCCO1)C1CCCS1 |
| InChI | InChI=1S/C10H16O2S/c11-10(9-5-3-7-13-9)8-4-1-2-6-12-8/h4,9-11H,1-3,5-7H2 |
| InChIKey | WZLAAFOOQRBFQP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |