C9H15NO2 — CID 164662095
2,3-dihydrofuran-5-yl-[(2R)-pyrrolidin-2-yl]methanol (PubChem CID 164662095) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-[(2R)-pyrrolidin-2-yl]methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-[(2R)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 164662095 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-[(2R)-pyrrolidin-2-yl]methanol |
| SMILES | OC(C1=CCCO1)[C@H]1CCCN1 |
| InChI | InChI=1S/C9H15NO2/c11-9(7-3-1-5-10-7)8-4-2-6-12-8/h4,7,9-11H,1-3,5-6H2/t7-,9?/m1/s1 |
| InChIKey | LERWHQZAXWJPBF-YOXFSPIKSA-N |
| XLogP | 0.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |