C12H18O2 — CID 102646802
cyclohexyl(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102646802) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is cyclohexyl(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | cyclohexyl(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 102646802 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | cyclohexyl(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)C1CCCCC1 |
| InChI | InChI=1S/C12H18O2/c13-12(10-6-2-1-3-7-10)11-8-4-5-9-14-11/h8,10H,1-7,9H2 |
| InChIKey | WOQIGMRLMPAPJK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |