C12H16O2 — CID 134933024
2-ethoxy-3a-methyl-5,6-dihydro-4H-inden-1-one (PubChem CID 134933024) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethoxy-3a-methyl-5,6-dihydro-4H-inden-1-one.
| Compound Name | 2-ethoxy-3a-methyl-5,6-dihydro-4H-inden-1-one |
|---|---|
| PubChem CID | 134933024 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-ethoxy-3a-methyl-5,6-dihydro-4H-inden-1-one |
| SMILES | CCOC1=CC2(C)CCCC=C2C1=O |
| InChI | InChI=1S/C12H16O2/c1-3-14-10-8-12(2)7-5-4-6-9(12)11(10)13/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | KAXGNPQKDQSCDS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |