C9H15NO — CID 102647142
cyclopropyl(3,4-dihydro-2H-pyran-6-yl)methanamine (PubChem CID 102647142) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is cyclopropyl(3,4-dihydro-2H-pyran-6-yl)methanamine.
| Compound Name | cyclopropyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
|---|---|
| PubChem CID | 102647142 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | cyclopropyl(3,4-dihydro-2H-pyran-6-yl)methanamine |
| SMILES | NC(C1=CCCCO1)C1CC1 |
| InChI | InChI=1S/C9H15NO/c10-9(7-4-5-7)8-3-1-2-6-11-8/h3,7,9H,1-2,4-6,10H2 |
| InChIKey | CDATZRSXBNAEJE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |