C9H13NO2 — CID 102648397
azetidin-3-yl(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102648397) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is azetidin-3-yl(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | azetidin-3-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 102648397 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | azetidin-3-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)C1CNC1 |
| InChI | InChI=1S/C9H13NO2/c11-9(7-5-10-6-7)8-3-1-2-4-12-8/h3,7,10H,1-2,4-6H2 |
| InChIKey | OPMUMDVCLACUDU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |