C9H15NO2 — CID 102648398
2-amino-1-(3,4-dihydro-2H-pyran-6-yl)butan-1-one (PubChem CID 102648398) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)butan-1-one.
| Compound Name | 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)butan-1-one |
|---|---|
| PubChem CID | 102648398 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)butan-1-one |
| SMILES | CCC(N)C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C9H15NO2/c1-2-7(10)9(11)8-5-3-4-6-12-8/h5,7H,2-4,6,10H2,1H3 |
| InChIKey | VLJBXQNIRAYSBR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |