C11H19NO2 — CID 102648300
2-amino-1-(3,4-dihydro-2H-pyran-6-yl)hexan-1-one (PubChem CID 102648300) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)hexan-1-one.
| Compound Name | 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)hexan-1-one |
|---|---|
| PubChem CID | 102648300 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-amino-1-(3,4-dihydro-2H-pyran-6-yl)hexan-1-one |
| SMILES | CCCCC(N)C(=O)C1=CCCCO1 |
| InChI | InChI=1S/C11H19NO2/c1-2-3-6-9(12)11(13)10-7-4-5-8-14-10/h7,9H,2-6,8,12H2,1H3 |
| InChIKey | ZRAIJZHCHWWVBV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |