C9H15NO3 — CID 102648422
2-(2-aminoethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)ethanone (PubChem CID 102648422) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)ethanone.
| Compound Name | 2-(2-aminoethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)ethanone |
|---|---|
| PubChem CID | 102648422 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-(2-aminoethoxy)-1-(3,4-dihydro-2H-pyran-6-yl)ethanone |
| SMILES | NCCOCC(=O)C1=CCCCO1 |
| InChI | InChI=1S/C9H15NO3/c10-4-6-12-7-8(11)9-3-1-2-5-13-9/h3H,1-2,4-7,10H2 |
| InChIKey | SXELOBVWJJVBPB-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|