C7H14N2O — CID 102649902
1-(3,4-dihydro-2H-pyran-6-yl)ethylhydrazine (PubChem CID 102649902) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)ethylhydrazine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)ethylhydrazine |
|---|---|
| PubChem CID | 102649902 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)ethylhydrazine |
| SMILES | CC(NN)C1=CCCCO1 |
| InChI | InChI=1S/C7H14N2O/c1-6(9-8)7-4-2-3-5-10-7/h4,6,9H,2-3,5,8H2,1H3 |
| InChIKey | MDESTTBJQGQJKJ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|