C12H22N2O2 — CID 102650142
[3,4-dihydro-2H-pyran-6-yl-(1-methoxycyclopentyl)methyl]hydrazine (PubChem CID 102650142) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl-(1-methoxycyclopentyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl-(1-methoxycyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102650142 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl-(1-methoxycyclopentyl)methyl]hydrazine |
| SMILES | COC1(C(NN)C2=CCCCO2)CCCC1 |
| InChI | InChI=1S/C12H22N2O2/c1-15-12(7-3-4-8-12)11(14-13)10-6-2-5-9-16-10/h6,11,14H,2-5,7-9,13H2,1H3 |
| InChIKey | VPFFSSCEHOMHDR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|