C12H24N2O2 — CID 102650156
[1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine (PubChem CID 102650156) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 102650156 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
| SMILES | COC(C(NN)C1=CCCCO1)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-12(2,3)11(15-4)10(14-13)9-7-5-6-8-16-9/h7,10-11,14H,5-6,8,13H2,1-4H3 |
| InChIKey | QABVKKAKWSSYHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|