C11H22N2O — CID 102650246
[1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylbutyl]hydrazine (PubChem CID 102650246) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylbutyl]hydrazine.
| Compound Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylbutyl]hydrazine |
|---|---|
| PubChem CID | 102650246 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | [1-(3,4-dihydro-2H-pyran-6-yl)-2-ethylbutyl]hydrazine |
| SMILES | CCC(CC)C(NN)C1=CCCCO1 |
| InChI | InChI=1S/C11H22N2O/c1-3-9(4-2)11(13-12)10-7-5-6-8-14-10/h7,9,11,13H,3-6,8,12H2,1-2H3 |
| InChIKey | ZJORPNNUZXPTQV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|