C13H24N2O2 — CID 102650322
[3,4-dihydro-2H-pyran-6-yl-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine (PubChem CID 102650322) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102650322 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1OC(C)C(C(NN)C2=CCCCO2)C1C |
| InChI | InChI=1S/C13H24N2O2/c1-8-9(2)17-10(3)12(8)13(15-14)11-6-4-5-7-16-11/h6,8-10,12-13,15H,4-5,7,14H2,1-3H3 |
| InChIKey | DEAPRVGQWLNQGW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|