C18H28N2O — CID 105338209
[(4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine (PubChem CID 105338209) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is [(4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine.
| Compound Name | [(4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105338209 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | [(4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methyl]hydrazine |
| SMILES | CC1OC(C)C(C(NN)c2ccc(C3CCC3)cc2)C1C |
| InChI | InChI=1S/C18H28N2O/c1-11-12(2)21-13(3)17(11)18(20-19)16-9-7-15(8-10-16)14-5-4-6-14/h7-14,17-18,20H,4-6,19H2,1-3H3 |
| InChIKey | WVZWAMMGMHKIHU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|