C18H26O2 — CID 115836255
(4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methanol (PubChem CID 115836255) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methanol.
| Compound Name | (4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methanol |
|---|---|
| PubChem CID | 115836255 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (4-cyclobutylphenyl)-(2,4,5-trimethyloxolan-3-yl)methanol |
| SMILES | CC1OC(C)C(C(O)c2ccc(C3CCC3)cc2)C1C |
| InChI | InChI=1S/C18H26O2/c1-11-12(2)20-13(3)17(11)18(19)16-9-7-15(8-10-16)14-5-4-6-14/h7-14,17-19H,4-6H2,1-3H3 |
| InChIKey | VLGSNFBNPLFGSW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |