C13H21F3N2O — CID 102650340
[3,4-dihydro-2H-pyran-6-yl-[2-(trifluoromethyl)cyclohexyl]methyl]hydrazine (PubChem CID 102650340) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-6-yl-[2-(trifluoromethyl)cyclohexyl]methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-6-yl-[2-(trifluoromethyl)cyclohexyl]methyl]hydrazine |
|---|---|
| PubChem CID | 102650340 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | [3,4-dihydro-2H-pyran-6-yl-[2-(trifluoromethyl)cyclohexyl]methyl]hydrazine |
| SMILES | NNC(C1=CCCCO1)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c14-13(15,16)10-6-2-1-5-9(10)12(18-17)11-7-3-4-8-19-11/h7,9-10,12,18H,1-6,8,17H2 |
| InChIKey | PPNCMOVERWZQGY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|