C11H18F2N2O — CID 102654507
[(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (PubChem CID 102654507) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
| Compound Name | [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654507 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2N2O/c12-11(13)5-3-8(4-6-11)10(15-14)9-2-1-7-16-9/h2,8,10,15H,1,3-7,14H2 |
| InChIKey | LSASIRWZWCZOAX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|