About [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine
[(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (PubChem CID 102654507) has the molecular formula C11H18F2N2O
and a molecular weight of 232.27 g/mol. Its IUPAC name is [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
Molecular Properties
| Compound Name | [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| PubChem CID | 102654507 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2N2O/c12-11(13)5-3-8(4-6-11)10(15-14)9-2-1-7-16-9/h2,8,10,15H,1,3-7,14H2 |
| InChIKey | LSASIRWZWCZOAX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine?
The IUPAC name of [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine (CID 102654507) is [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine.
What is the SMILES notation for [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine?
The canonical SMILES for [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine is NNC(C1=CCCO1)C1CCC(F)(F)CC1.
What is the InChIKey of [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine?
The InChIKey is LSASIRWZWCZOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2O/c12-11(13)5-3-8(4-6-11)10(15-14)9-2-1-7-16-9/h2,8,10,15H,1,3-7,14H2.
What are the key properties of [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine?
[(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine has a molecular weight of 232.27 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4,4-difluorocyclohexyl)-(2,3-dihydrofuran-5-yl)methyl]hydrazine is sourced from PubChem (CID 102654507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).