C9H16N2O2S — CID 102654255
[2,3-dihydrofuran-5-yl(1,4-oxathian-2-yl)methyl]hydrazine (PubChem CID 102654255) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is [2,3-dihydrofuran-5-yl(1,4-oxathian-2-yl)methyl]hydrazine.
| Compound Name | [2,3-dihydrofuran-5-yl(1,4-oxathian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102654255 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | [2,3-dihydrofuran-5-yl(1,4-oxathian-2-yl)methyl]hydrazine |
| SMILES | NNC(C1=CCCO1)C1CSCCO1 |
| InChI | InChI=1S/C9H16N2O2S/c10-11-9(7-2-1-3-12-7)8-6-14-5-4-13-8/h2,8-9,11H,1,3-6,10H2 |
| InChIKey | VWKOWTYXXIUONZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|