C12H18N2OS — CID 105249537
[(4-methylphenyl)-(1,4-oxathian-2-yl)methyl]hydrazine (PubChem CID 105249537) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is [(4-methylphenyl)-(1,4-oxathian-2-yl)methyl]hydrazine.
| Compound Name | [(4-methylphenyl)-(1,4-oxathian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249537 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [(4-methylphenyl)-(1,4-oxathian-2-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)C2CSCCO2)cc1 |
| InChI | InChI=1S/C12H18N2OS/c1-9-2-4-10(5-3-9)12(14-13)11-8-16-7-6-15-11/h2-5,11-12,14H,6-8,13H2,1H3 |
| InChIKey | BTEONRBLLHLVRS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|