C12H11ClO2 — CID 102650858
2-(4-chlorophenyl)-1-(2,3-dihydrofuran-5-yl)ethanone (PubChem CID 102650858) has the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,3-dihydrofuran-5-yl)ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-(2,3-dihydrofuran-5-yl)ethanone |
|---|---|
| PubChem CID | 102650858 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,3-dihydrofuran-5-yl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)C1=CCCO1 |
| InChI | InChI=1S/C12H11ClO2/c13-10-5-3-9(4-6-10)8-11(14)12-2-1-7-15-12/h2-6H,1,7-8H2 |
| InChIKey | NMXHBJPWXFRXDB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |