C11H19NO — CID 102651222
cyclohexyl(2,3-dihydrofuran-5-yl)methanamine (PubChem CID 102651222) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is cyclohexyl(2,3-dihydrofuran-5-yl)methanamine.
| Compound Name | cyclohexyl(2,3-dihydrofuran-5-yl)methanamine |
|---|---|
| PubChem CID | 102651222 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | cyclohexyl(2,3-dihydrofuran-5-yl)methanamine |
| SMILES | NC(C1=CCCO1)C1CCCCC1 |
| InChI | InChI=1S/C11H19NO/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h7,9,11H,1-6,8,12H2 |
| InChIKey | DVQIEIPXQLZMHK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |