C8H13NO — CID 102651224
cyclopropyl(2,3-dihydrofuran-5-yl)methanamine (PubChem CID 102651224) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is cyclopropyl(2,3-dihydrofuran-5-yl)methanamine.
| Compound Name | cyclopropyl(2,3-dihydrofuran-5-yl)methanamine |
|---|---|
| PubChem CID | 102651224 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | cyclopropyl(2,3-dihydrofuran-5-yl)methanamine |
| SMILES | NC(C1=CCCO1)C1CC1 |
| InChI | InChI=1S/C8H13NO/c9-8(6-3-4-6)7-2-1-5-10-7/h2,6,8H,1,3-5,9H2 |
| InChIKey | WBFABWDVMYVBEK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |