C12H21NOS — CID 102651642
2-cyclohexylsulfanyl-1-(2,3-dihydrofuran-5-yl)ethanamine (PubChem CID 102651642) has the molecular formula C12H21NOS and a molecular weight of 227.37 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-1-(2,3-dihydrofuran-5-yl)ethanamine.
| Compound Name | 2-cyclohexylsulfanyl-1-(2,3-dihydrofuran-5-yl)ethanamine |
|---|---|
| PubChem CID | 102651642 |
| Molecular Formula | C12H21NOS |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-cyclohexylsulfanyl-1-(2,3-dihydrofuran-5-yl)ethanamine |
| SMILES | NC(CSC1CCCCC1)C1=CCCO1 |
| InChI | InChI=1S/C12H21NOS/c13-11(12-7-4-8-14-12)9-15-10-5-2-1-3-6-10/h7,10-11H,1-6,8-9,13H2 |
| InChIKey | UHEQBOZHVIUHKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |