C13H23NO2 — CID 102652274
2,3-dihydrofuran-5-yl-(1-methoxycycloheptyl)methanamine (PubChem CID 102652274) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(1-methoxycycloheptyl)methanamine.
| Compound Name | 2,3-dihydrofuran-5-yl-(1-methoxycycloheptyl)methanamine |
|---|---|
| PubChem CID | 102652274 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(1-methoxycycloheptyl)methanamine |
| SMILES | COC1(C(N)C2=CCCO2)CCCCCC1 |
| InChI | InChI=1S/C13H23NO2/c1-15-13(8-4-2-3-5-9-13)12(14)11-7-6-10-16-11/h7,12H,2-6,8-10,14H2,1H3 |
| InChIKey | VHVKFDTYBLMAPQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |