C11H18O3 — CID 102654861
2,3-dihydrofuran-5-yl-(1-methoxycyclopentyl)methanol (PubChem CID 102654861) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl-(1-methoxycyclopentyl)methanol.
| Compound Name | 2,3-dihydrofuran-5-yl-(1-methoxycyclopentyl)methanol |
|---|---|
| PubChem CID | 102654861 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,3-dihydrofuran-5-yl-(1-methoxycyclopentyl)methanol |
| SMILES | COC1(C(O)C2=CCCO2)CCCC1 |
| InChI | InChI=1S/C11H18O3/c1-13-11(6-2-3-7-11)10(12)9-5-4-8-14-9/h5,10,12H,2-4,6-8H2,1H3 |
| InChIKey | YMPSKXIRDVABLQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |