C9H15NO2 — CID 102652447
1-(2,3-dihydrofuran-5-yl)-2-(propylamino)ethanone (PubChem CID 102652447) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2-(propylamino)ethanone.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2-(propylamino)ethanone |
|---|---|
| PubChem CID | 102652447 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2-(propylamino)ethanone |
| SMILES | CCCNCC(=O)C1=CCCO1 |
| InChI | InChI=1S/C9H15NO2/c1-2-5-10-7-8(11)9-4-3-6-12-9/h4,10H,2-3,5-7H2,1H3 |
| InChIKey | OALUZZQLQXWZJI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|