C9H15NO3 — CID 102652548
1-(2,3-dihydrofuran-5-yl)-2-(2-methoxyethylamino)ethanone (PubChem CID 102652548) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 102652548 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)C1=CCCO1 |
| InChI | InChI=1S/C9H15NO3/c1-12-6-4-10-7-8(11)9-3-2-5-13-9/h3,10H,2,4-7H2,1H3 |
| InChIKey | SEVFRBJWHVCXMD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|