C13H18N2O2 — CID 102654039
[1-(2,3-dihydrofuran-5-yl)-3-phenoxypropyl]hydrazine (PubChem CID 102654039) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is [1-(2,3-dihydrofuran-5-yl)-3-phenoxypropyl]hydrazine.
| Compound Name | [1-(2,3-dihydrofuran-5-yl)-3-phenoxypropyl]hydrazine |
|---|---|
| PubChem CID | 102654039 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [1-(2,3-dihydrofuran-5-yl)-3-phenoxypropyl]hydrazine |
| SMILES | NNC(CCOc1ccccc1)C1=CCCO1 |
| InChI | InChI=1S/C13H18N2O2/c14-15-12(13-7-4-9-17-13)8-10-16-11-5-2-1-3-6-11/h1-3,5-7,12,15H,4,8-10,14H2 |
| InChIKey | ICLYBJLPSBNZKF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|