C9H18N2O2 — CID 102654328
[1-(2,3-dihydrofuran-5-yl)-2-methoxybutyl]hydrazine (PubChem CID 102654328) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is [1-(2,3-dihydrofuran-5-yl)-2-methoxybutyl]hydrazine.
| Compound Name | [1-(2,3-dihydrofuran-5-yl)-2-methoxybutyl]hydrazine |
|---|---|
| PubChem CID | 102654328 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | [1-(2,3-dihydrofuran-5-yl)-2-methoxybutyl]hydrazine |
| SMILES | CCC(OC)C(NN)C1=CCCO1 |
| InChI | InChI=1S/C9H18N2O2/c1-3-7(12-2)9(11-10)8-5-4-6-13-8/h5,7,9,11H,3-4,6,10H2,1-2H3 |
| InChIKey | AYFPVGQCUWGVKX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|