C6H12N2O3 — CID 102656216
N-hydroxy-2-(3-methylazetidin-3-yl)oxyacetamide (PubChem CID 102656216) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is N-hydroxy-2-(3-methylazetidin-3-yl)oxyacetamide.
| Compound Name | N-hydroxy-2-(3-methylazetidin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 102656216 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | N-hydroxy-2-(3-methylazetidin-3-yl)oxyacetamide |
| SMILES | CC1(OCC(=O)NO)CNC1 |
| InChI | InChI=1S/C6H12N2O3/c1-6(3-7-4-6)11-2-5(9)8-10/h7,10H,2-4H2,1H3,(H,8,9) |
| InChIKey | ZBODOSHEWUZDSP-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|