C10H16N2O6 — CID 102656442
2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]butanedioic acid (PubChem CID 102656442) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 102656442 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]butanedioic acid |
| SMILES | CC1(OCC(=O)NC(CC(=O)O)C(=O)O)CNC1 |
| InChI | InChI=1S/C10H16N2O6/c1-10(4-11-5-10)18-3-7(13)12-6(9(16)17)2-8(14)15/h6,11H,2-5H2,1H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | ZWGKANFGHYCCHF-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |