C12H20N2O6 — CID 102656504
5-methoxy-2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]-5-oxopentanoic acid (PubChem CID 102656504) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is 5-methoxy-2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-methoxy-2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102656504 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-methoxy-2-[[2-(3-methylazetidin-3-yl)oxyacetyl]amino]-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)COC1(C)CNC1)C(=O)O |
| InChI | InChI=1S/C12H20N2O6/c1-12(6-13-7-12)20-5-9(15)14-8(11(17)18)3-4-10(16)19-2/h8,13H,3-7H2,1-2H3,(H,14,15)(H,17,18) |
| InChIKey | BGPFVOGZGIEZNA-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |