C10H18N2O6 — CID 82786420
2-[[2-(2-aminoethoxy)acetyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 82786420) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[[2-(2-aminoethoxy)acetyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-[[2-(2-aminoethoxy)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82786420 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[[2-(2-aminoethoxy)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)COCCN)C(=O)O |
| InChI | InChI=1S/C10H18N2O6/c1-17-9(14)3-2-7(10(15)16)12-8(13)6-18-5-4-11/h7H,2-6,11H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | LIANMAZDCANAMI-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|