C12H21NO6 — CID 107820770
(2R)-2-(4-ethoxybutanoylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 107820770) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is (2R)-2-(4-ethoxybutanoylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-(4-ethoxybutanoylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820770 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (2R)-2-(4-ethoxybutanoylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | CCOCCCC(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C12H21NO6/c1-3-19-8-4-5-10(14)13-9(12(16)17)6-7-11(15)18-2/h9H,3-8H2,1-2H3,(H,13,14)(H,16,17)/t9-/m1/s1 |
| InChIKey | MZHQYAPZWDOQQU-SECBINFHSA-N |
| XLogP | 0.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|