C11H22N2O3S — CID 106161497
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(3-methylazetidin-3-yl)oxyacetamide (PubChem CID 106161497) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(3-methylazetidin-3-yl)oxyacetamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(3-methylazetidin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 106161497 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-(3-methylazetidin-3-yl)oxyacetamide |
| SMILES | CSC(CO)C(C)NC(=O)COC1(C)CNC1 |
| InChI | InChI=1S/C11H22N2O3S/c1-8(9(4-14)17-3)13-10(15)5-16-11(2)6-12-7-11/h8-9,12,14H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | BJNRPSFDAPABAO-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |