C12H20N2O2 — CID 102656645
2-(3-methylazetidin-3-yl)oxy-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone (PubChem CID 102656645) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(3-methylazetidin-3-yl)oxy-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone.
| Compound Name | 2-(3-methylazetidin-3-yl)oxy-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 102656645 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-(3-methylazetidin-3-yl)oxy-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone |
| SMILES | CC1=CCN(C(=O)COC2(C)CNC2)CC1 |
| InChI | InChI=1S/C12H20N2O2/c1-10-3-5-14(6-4-10)11(15)7-16-12(2)8-13-9-12/h3,13H,4-9H2,1-2H3 |
| InChIKey | NLHDFPVETWFTAY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|