C14H22N2O2 — CID 50972729
2-methoxy-N-[(1-pent-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)methyl]acetamide (PubChem CID 50972729) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-methoxy-N-[(1-pent-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)methyl]acetamide.
| Compound Name | 2-methoxy-N-[(1-pent-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 50972729 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-methoxy-N-[(1-pent-2-ynyl-3,6-dihydro-2H-pyridin-4-yl)methyl]acetamide |
| SMILES | CCC#CCN1CC=C(CNC(=O)COC)CC1 |
| InChI | InChI=1S/C14H22N2O2/c1-3-4-5-8-16-9-6-13(7-10-16)11-15-14(17)12-18-2/h6H,3,7-12H2,1-2H3,(H,15,17) |
| InChIKey | GQYFFQQDKQITFQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|