C11H17NO2 — CID 143852733
N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methoxyacetamide (PubChem CID 143852733) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methoxyacetamide.
| Compound Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 143852733 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-2-methoxyacetamide |
| SMILES | C=C/C=C\C(=C/C)CNC(=O)COC |
| InChI | InChI=1S/C11H17NO2/c1-4-6-7-10(5-2)8-12-11(13)9-14-3/h4-7H,1,8-9H2,2-3H3,(H,12,13)/b7-6-,10-5+ |
| InChIKey | WOBJNEBXOXGYJG-JQEGGOPCSA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|