C10H15NO4 — CID 102657283
2-(1-but-3-enoyl-3-methylazetidin-3-yl)oxyacetic acid (PubChem CID 102657283) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-(1-but-3-enoyl-3-methylazetidin-3-yl)oxyacetic acid.
| Compound Name | 2-(1-but-3-enoyl-3-methylazetidin-3-yl)oxyacetic acid |
|---|---|
| PubChem CID | 102657283 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(1-but-3-enoyl-3-methylazetidin-3-yl)oxyacetic acid |
| SMILES | C=CCC(=O)N1CC(C)(OCC(=O)O)C1 |
| InChI | InChI=1S/C10H15NO4/c1-3-4-8(12)11-6-10(2,7-11)15-5-9(13)14/h3H,1,4-7H2,2H3,(H,13,14) |
| InChIKey | PQGWAGFNXTZWQR-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|