C12H21NO5 — CID 102657646
2-[3-methyl-1-(3-propoxypropanoyl)azetidin-3-yl]oxyacetic acid (PubChem CID 102657646) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[3-methyl-1-(3-propoxypropanoyl)azetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[3-methyl-1-(3-propoxypropanoyl)azetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102657646 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-[3-methyl-1-(3-propoxypropanoyl)azetidin-3-yl]oxyacetic acid |
| SMILES | CCCOCCC(=O)N1CC(C)(OCC(=O)O)C1 |
| InChI | InChI=1S/C12H21NO5/c1-3-5-17-6-4-10(14)13-8-12(2,9-13)18-7-11(15)16/h3-9H2,1-2H3,(H,15,16) |
| InChIKey | ZHQVNUUIJAKAST-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|