C15H28N2O4 — CID 102658314
2-[1-[4-(2-aminoethyl)-5-methylhexanoyl]-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102658314) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[1-[4-(2-aminoethyl)-5-methylhexanoyl]-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[4-(2-aminoethyl)-5-methylhexanoyl]-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102658314 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 2-[1-[4-(2-aminoethyl)-5-methylhexanoyl]-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CC(C)C(CCN)CCC(=O)N1CC(C)(OCC(=O)O)C1 |
| InChI | InChI=1S/C15H28N2O4/c1-11(2)12(6-7-16)4-5-13(18)17-9-15(3,10-17)21-8-14(19)20/h11-12H,4-10,16H2,1-3H3,(H,19,20) |
| InChIKey | IYJGZLZMUCJKQD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |