C14H18FNO4 — CID 102659234
2-[1-[2-(4-fluorophenoxy)ethyl]-3-methylazetidin-3-yl]oxyacetic acid (PubChem CID 102659234) has the molecular formula C14H18FNO4 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-[1-[2-(4-fluorophenoxy)ethyl]-3-methylazetidin-3-yl]oxyacetic acid.
| Compound Name | 2-[1-[2-(4-fluorophenoxy)ethyl]-3-methylazetidin-3-yl]oxyacetic acid |
|---|---|
| PubChem CID | 102659234 |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[1-[2-(4-fluorophenoxy)ethyl]-3-methylazetidin-3-yl]oxyacetic acid |
| SMILES | CC1(OCC(=O)O)CN(CCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C14H18FNO4/c1-14(20-8-13(17)18)9-16(10-14)6-7-19-12-4-2-11(15)3-5-12/h2-5H,6-10H2,1H3,(H,17,18) |
| InChIKey | OGGSUJVKYYKAEN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |